C17H17NO4S — CID 110714208
1-(1,3-benzodioxol-5-ylsulfonyl)-6-methyl-3,4-dihydro-2H-quinoline (PubChem CID 110714208) has the molecular formula C17H17NO4S and a molecular weight of 331.39 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylsulfonyl)-6-methyl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-(1,3-benzodioxol-5-ylsulfonyl)-6-methyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 110714208 |
| Molecular Formula | C17H17NO4S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylsulfonyl)-6-methyl-3,4-dihydro-2H-quinoline |
| SMILES | Cc1ccc2c(c1)CCCN2S(=O)(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H17NO4S/c1-12-4-6-15-13(9-12)3-2-8-18(15)23(19,20)14-5-7-16-17(10-14)22-11-21-16/h4-7,9-10H,2-3,8,11H2,1H3 |
| InChIKey | LRCSXTHAODYMQM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |