C17H15NO5S — CID 110406441
1-(1,3-benzodioxol-5-ylsulfonyl)-6-methyl-2,3-dihydroquinolin-4-one (PubChem CID 110406441) has the molecular formula C17H15NO5S and a molecular weight of 345.38 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylsulfonyl)-6-methyl-2,3-dihydroquinolin-4-one.
| Compound Name | 1-(1,3-benzodioxol-5-ylsulfonyl)-6-methyl-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 110406441 |
| Molecular Formula | C17H15NO5S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylsulfonyl)-6-methyl-2,3-dihydroquinolin-4-one |
| SMILES | Cc1ccc2c(c1)C(=O)CCN2S(=O)(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H15NO5S/c1-11-2-4-14-13(8-11)15(19)6-7-18(14)24(20,21)12-3-5-16-17(9-12)23-10-22-16/h2-5,8-9H,6-7,10H2,1H3 |
| InChIKey | FMXYHKFGOVHYPA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |