C14H11ClN2O3S — CID 1093239
4-(4-chlorophenyl)sulfonyl-1,3-dihydroquinoxalin-2-one (PubChem CID 1093239) has the molecular formula C14H11ClN2O3S and a molecular weight of 322.77 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfonyl-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-(4-chlorophenyl)sulfonyl-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 1093239 |
| Molecular Formula | C14H11ClN2O3S |
| Molecular Weight | 322.77 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 4-(4-chlorophenyl)sulfonyl-1,3-dihydroquinoxalin-2-one |
| SMILES | O=C1CN(S(=O)(=O)c2ccc(Cl)cc2)c2ccccc2N1 |
| InChI | InChI=1S/C14H11ClN2O3S/c15-10-5-7-11(8-6-10)21(19,20)17-9-14(18)16-12-3-1-2-4-13(12)17/h1-8H,9H2,(H,16,18) |
| InChIKey | DJPSCONZKNJHKI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.77 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |