C15H14N2O — CID 759495
4-benzyl-1,3-dihydroquinoxalin-2-one (PubChem CID 759495) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 4-benzyl-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-benzyl-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 759495 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 4-benzyl-1,3-dihydroquinoxalin-2-one |
| SMILES | O=C1CN(Cc2ccccc2)c2ccccc2N1 |
| InChI | InChI=1S/C15H14N2O/c18-15-11-17(10-12-6-2-1-3-7-12)14-9-5-4-8-13(14)16-15/h1-9H,10-11H2,(H,16,18) |
| InChIKey | BSCQZYGHGGBKLI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |