About 5-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)-2-methoxyaniline
5-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)-2-methoxyaniline (PubChem CID 71493050) has the molecular formula C15H16N2O4S
and a molecular weight of 320.37 g/mol. Its IUPAC name is 5-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)-2-methoxyaniline.
Molecular Properties
| Compound Name | 5-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)-2-methoxyaniline |
| PubChem CID | 71493050 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 5-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)-2-methoxyaniline |
| SMILES | COc1ccc(S(=O)(=O)N2CCOc3ccccc32)cc1N |
| InChI | InChI=1S/C15H16N2O4S/c1-20-14-7-6-11(10-12(14)16)22(18,19)17-8-9-21-15-5-3-2-4-13(15)17/h2-7,10H,8-9,16H2,1H3 |
| InChIKey | IGPXRXJERPINGE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)-2-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)-2-methoxyaniline?
The IUPAC name of 5-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)-2-methoxyaniline (CID 71493050) is 5-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)-2-methoxyaniline.
What is the SMILES notation for 5-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)-2-methoxyaniline?
The canonical SMILES for 5-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)-2-methoxyaniline is COc1ccc(S(=O)(=O)N2CCOc3ccccc32)cc1N.
What is the InChIKey of 5-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)-2-methoxyaniline?
The InChIKey is IGPXRXJERPINGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O4S/c1-20-14-7-6-11(10-12(14)16)22(18,19)17-8-9-21-15-5-3-2-4-13(15)17/h2-7,10H,8-9,16H2,1H3.
What are the key properties of 5-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)-2-methoxyaniline?
5-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)-2-methoxyaniline has a molecular weight of 320.37 g/mol, XLogP of 1.87, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)-2-methoxyaniline is sourced from PubChem (CID 71493050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).