C14H11ClN2O5S — CID 156859794
7-chloro-4-(3-nitrophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 156859794) has the molecular formula C14H11ClN2O5S and a molecular weight of 354.77 g/mol. Its IUPAC name is 7-chloro-4-(3-nitrophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 7-chloro-4-(3-nitrophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 156859794 |
| Molecular Formula | C14H11ClN2O5S |
| Molecular Weight | 354.77 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 7-chloro-4-(3-nitrophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)N2CCOc3cc(Cl)ccc32)c1 |
| InChI | InChI=1S/C14H11ClN2O5S/c15-10-4-5-13-14(8-10)22-7-6-16(13)23(20,21)12-3-1-2-11(9-12)17(18)19/h1-5,8-9H,6-7H2 |
| InChIKey | ABSUHQSKCQMABQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.77 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|