C14H11ClFNO3S — CID 110639406
4-(3-chlorophenyl)sulfonyl-6-fluoro-2,3-dihydro-1,4-benzoxazine (PubChem CID 110639406) has the molecular formula C14H11ClFNO3S and a molecular weight of 327.76 g/mol. Its IUPAC name is 4-(3-chlorophenyl)sulfonyl-6-fluoro-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 4-(3-chlorophenyl)sulfonyl-6-fluoro-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 110639406 |
| Molecular Formula | C14H11ClFNO3S |
| Molecular Weight | 327.76 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 4-(3-chlorophenyl)sulfonyl-6-fluoro-2,3-dihydro-1,4-benzoxazine |
| SMILES | O=S(=O)(c1cccc(Cl)c1)N1CCOc2ccc(F)cc21 |
| InChI | InChI=1S/C14H11ClFNO3S/c15-10-2-1-3-12(8-10)21(18,19)17-6-7-20-14-5-4-11(16)9-13(14)17/h1-5,8-9H,6-7H2 |
| InChIKey | CWAYCCICILCPTK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.76 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |