C21H28N2O6SSi — CID 23120103
tert-butyl-dimethyl-[[5-(3-nitrophenyl)sulfonyl-3,4-dihydro-2H-1,5-benzoxazepin-3-yl]oxy]silane (PubChem CID 23120103) has the molecular formula C21H28N2O6SSi and a molecular weight of 464.62 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[5-(3-nitrophenyl)sulfonyl-3,4-dihydro-2H-1,5-benzoxazepin-3-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[5-(3-nitrophenyl)sulfonyl-3,4-dihydro-2H-1,5-benzoxazepin-3-yl]oxy]silane |
|---|---|
| PubChem CID | 23120103 |
| Molecular Formula | C21H28N2O6SSi |
| Molecular Weight | 464.62 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | tert-butyl-dimethyl-[[5-(3-nitrophenyl)sulfonyl-3,4-dihydro-2H-1,5-benzoxazepin-3-yl]oxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OC1COc2ccccc2N(S(=O)(=O)c2cccc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C21H28N2O6SSi/c1-21(2,3)31(4,5)29-17-14-22(19-11-6-7-12-20(19)28-15-17)30(26,27)18-10-8-9-16(13-18)23(24)25/h6-13,17H,14-15H2,1-5H3 |
| InChIKey | SPKXZEZOCZDYOQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.62 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|