C18H19N3O6S — CID 38942070
(2R)-N,N-dimethyl-4-(4-methyl-3-nitrophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 38942070) has the molecular formula C18H19N3O6S and a molecular weight of 405.43 g/mol. Its IUPAC name is (2R)-N,N-dimethyl-4-(4-methyl-3-nitrophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2R)-N,N-dimethyl-4-(4-methyl-3-nitrophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 38942070 |
| Molecular Formula | C18H19N3O6S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | (2R)-N,N-dimethyl-4-(4-methyl-3-nitrophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H](C(=O)N(C)C)Oc3ccccc32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19N3O6S/c1-12-8-9-13(10-15(12)21(23)24)28(25,26)20-11-17(18(22)19(2)3)27-16-7-5-4-6-14(16)20/h4-10,17H,11H2,1-3H3/t17-/m1/s1 |
| InChIKey | CMJKQSJAAGJDQL-QGZVFWFLSA-N |
| XLogP | 1.95 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|