C14H19N3O5S — CID 40882604
(2S)-N,N-dimethyl-1-(4-methyl-3-nitrophenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 40882604) has the molecular formula C14H19N3O5S and a molecular weight of 341.39 g/mol. Its IUPAC name is (2S)-N,N-dimethyl-1-(4-methyl-3-nitrophenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-N,N-dimethyl-1-(4-methyl-3-nitrophenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 40882604 |
| Molecular Formula | C14H19N3O5S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | (2S)-N,N-dimethyl-1-(4-methyl-3-nitrophenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC[C@H]2C(=O)N(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H19N3O5S/c1-10-6-7-11(9-13(10)17(19)20)23(21,22)16-8-4-5-12(16)14(18)15(2)3/h6-7,9,12H,4-5,8H2,1-3H3/t12-/m0/s1 |
| InChIKey | MCNGYXKKLBMLEO-LBPRGKRZSA-N |
| XLogP | 1.14 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|