C15H10Cl2N2O4S — CID 51031411
N-[3-(3,4-dichlorophenyl)prop-2-ynyl]-2-nitrobenzenesulfonamide (PubChem CID 51031411) has the molecular formula C15H10Cl2N2O4S and a molecular weight of 385.23 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)prop-2-ynyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[3-(3,4-dichlorophenyl)prop-2-ynyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 51031411 |
| Molecular Formula | C15H10Cl2N2O4S |
| Molecular Weight | 385.23 g/mol |
| Exact Mass | 383.97 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)prop-2-ynyl]-2-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)NCC#Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H10Cl2N2O4S/c16-12-8-7-11(10-13(12)17)4-3-9-18-24(22,23)15-6-2-1-5-14(15)19(20)21/h1-2,5-8,10,18H,9H2 |
| InChIKey | PDTVIIWDTIPJNO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|