C13H9ClF2N2O4S — CID 3773427
N-[(3-chloro-2,6-difluorophenyl)methyl]-2-nitrobenzenesulfonamide (PubChem CID 3773427) has the molecular formula C13H9ClF2N2O4S and a molecular weight of 362.74 g/mol. Its IUPAC name is N-[(3-chloro-2,6-difluorophenyl)methyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[(3-chloro-2,6-difluorophenyl)methyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 3773427 |
| Molecular Formula | C13H9ClF2N2O4S |
| Molecular Weight | 362.74 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | N-[(3-chloro-2,6-difluorophenyl)methyl]-2-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)NCc1c(F)ccc(Cl)c1F |
| InChI | InChI=1S/C13H9ClF2N2O4S/c14-9-5-6-10(15)8(13(9)16)7-17-23(21,22)12-4-2-1-3-11(12)18(19)20/h1-6,17H,7H2 |
| InChIKey | BSKXGFVHJHKCSS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.74 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|