C13H9ClF3NO2S — CID 5179910
N-[(3-chloro-2,6-difluorophenyl)methyl]-3-fluorobenzenesulfonamide (PubChem CID 5179910) has the molecular formula C13H9ClF3NO2S and a molecular weight of 335.73 g/mol. Its IUPAC name is N-[(3-chloro-2,6-difluorophenyl)methyl]-3-fluorobenzenesulfonamide.
| Compound Name | N-[(3-chloro-2,6-difluorophenyl)methyl]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 5179910 |
| Molecular Formula | C13H9ClF3NO2S |
| Molecular Weight | 335.73 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | N-[(3-chloro-2,6-difluorophenyl)methyl]-3-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCc1c(F)ccc(Cl)c1F)c1cccc(F)c1 |
| InChI | InChI=1S/C13H9ClF3NO2S/c14-11-4-5-12(16)10(13(11)17)7-18-21(19,20)9-3-1-2-8(15)6-9/h1-6,18H,7H2 |
| InChIKey | CGXFGZPAAZQKGD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.73 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|