C13H10Cl2FNO2S — CID 3858076
N-[(3,5-dichlorophenyl)methyl]-3-fluorobenzenesulfonamide (PubChem CID 3858076) has the molecular formula C13H10Cl2FNO2S and a molecular weight of 334.20 g/mol. Its IUPAC name is N-[(3,5-dichlorophenyl)methyl]-3-fluorobenzenesulfonamide.
| Compound Name | N-[(3,5-dichlorophenyl)methyl]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 3858076 |
| Molecular Formula | C13H10Cl2FNO2S |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | N-[(3,5-dichlorophenyl)methyl]-3-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCc1cc(Cl)cc(Cl)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C13H10Cl2FNO2S/c14-10-4-9(5-11(15)6-10)8-17-20(18,19)13-3-1-2-12(16)7-13/h1-7,17H,8H2 |
| InChIKey | CTOSVCFCFXGUAP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |