C13H9Cl4NO2S — CID 2805810
3,4-dichloro-N-[(3,5-dichlorophenyl)methyl]benzenesulfonamide (PubChem CID 2805810) has the molecular formula C13H9Cl4NO2S and a molecular weight of 385.10 g/mol. Its IUPAC name is 3,4-dichloro-N-[(3,5-dichlorophenyl)methyl]benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-[(3,5-dichlorophenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2805810 |
| Molecular Formula | C13H9Cl4NO2S |
| Molecular Weight | 385.10 g/mol |
| Exact Mass | 382.91 |
| IUPAC Name | 3,4-dichloro-N-[(3,5-dichlorophenyl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1cc(Cl)cc(Cl)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H9Cl4NO2S/c14-9-3-8(4-10(15)5-9)7-18-21(19,20)11-1-2-12(16)13(17)6-11/h1-6,18H,7H2 |
| InChIKey | BMWMUHWZQNGOLG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.10 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |