C8H8Cl2FNO2S — CID 87814655
3,4-dichloro-N-(2-fluoroethyl)benzenesulfonamide (PubChem CID 87814655) has the molecular formula C8H8Cl2FNO2S and a molecular weight of 272.13 g/mol. Its IUPAC name is 3,4-dichloro-N-(2-fluoroethyl)benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-(2-fluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 87814655 |
| Molecular Formula | C8H8Cl2FNO2S |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 270.96 |
| IUPAC Name | 3,4-dichloro-N-(2-fluoroethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCF)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H8Cl2FNO2S/c9-7-2-1-6(5-8(7)10)15(13,14)12-4-3-11/h1-2,5,12H,3-4H2 |
| InChIKey | NNPNBCZFBCMGHD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |