C6H6Cl2N2O2S — CID 2735965
3,4-dichlorobenzenesulfonohydrazide (PubChem CID 2735965) has the molecular formula C6H6Cl2N2O2S and a molecular weight of 241.10 g/mol. Its IUPAC name is 3,4-dichlorobenzenesulfonohydrazide.
| Compound Name | 3,4-dichlorobenzenesulfonohydrazide |
|---|---|
| PubChem CID | 2735965 |
| Molecular Formula | C6H6Cl2N2O2S |
| Molecular Weight | 241.10 g/mol |
| Exact Mass | 239.95 |
| IUPAC Name | 3,4-dichlorobenzenesulfonohydrazide |
| SMILES | NNS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C6H6Cl2N2O2S/c7-5-2-1-4(3-6(5)8)13(11,12)10-9/h1-3,10H,9H2 |
| InChIKey | FKLGJXZMKOGQAF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.10 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|