C7H5Cl2NO2S3 — CID 20570287
(3,4-dichlorophenyl)sulfonylcarbamodithioic acid (PubChem CID 20570287) has the molecular formula C7H5Cl2NO2S3 and a molecular weight of 302.23 g/mol. Its IUPAC name is (3,4-dichlorophenyl)sulfonylcarbamodithioic acid.
| Compound Name | (3,4-dichlorophenyl)sulfonylcarbamodithioic acid |
|---|---|
| PubChem CID | 20570287 |
| Molecular Formula | C7H5Cl2NO2S3 |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 300.89 |
| IUPAC Name | (3,4-dichlorophenyl)sulfonylcarbamodithioic acid |
| SMILES | O=S(=O)(NC(=S)S)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C7H5Cl2NO2S3/c8-5-2-1-4(3-6(5)9)15(11,12)10-7(13)14/h1-3H,(H2,10,13,14) |
| InChIKey | CKKSERNJXGUCAR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|