C10H6BrCl2N3O3S2 — CID 24752362
1-(5-bromo-1,3-thiazol-2-yl)-3-(3,4-dichlorophenyl)sulfonylurea (PubChem CID 24752362) has the molecular formula C10H6BrCl2N3O3S2 and a molecular weight of 431.12 g/mol. Its IUPAC name is 1-(5-bromo-1,3-thiazol-2-yl)-3-(3,4-dichlorophenyl)sulfonylurea.
| Compound Name | 1-(5-bromo-1,3-thiazol-2-yl)-3-(3,4-dichlorophenyl)sulfonylurea |
|---|---|
| PubChem CID | 24752362 |
| Molecular Formula | C10H6BrCl2N3O3S2 |
| Molecular Weight | 431.12 g/mol |
| Exact Mass | 428.84 |
| IUPAC Name | 1-(5-bromo-1,3-thiazol-2-yl)-3-(3,4-dichlorophenyl)sulfonylurea |
| SMILES | O=C(Nc1ncc(Br)s1)NS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H6BrCl2N3O3S2/c11-8-4-14-10(20-8)15-9(17)16-21(18,19)5-1-2-6(12)7(13)3-5/h1-4H,(H2,14,15,16,17) |
| InChIKey | POUXHUUOMBBCQP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.12 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |