C14H10BrFN4O3S3 — CID 24780310
1-(5-bromo-1,3-thiazol-2-yl)-3-[5-(6-fluoro-3-pyridinyl)-4-methylthiophen-2-yl]sulfonylurea (PubChem CID 24780310) has the molecular formula C14H10BrFN4O3S3 and a molecular weight of 477.36 g/mol. Its IUPAC name is 1-(5-bromo-1,3-thiazol-2-yl)-3-[5-(6-fluoro-3-pyridinyl)-4-methylthiophen-2-yl]sulfonylurea.
| Compound Name | 1-(5-bromo-1,3-thiazol-2-yl)-3-[5-(6-fluoro-3-pyridinyl)-4-methylthiophen-2-yl]sulfonylurea |
|---|---|
| PubChem CID | 24780310 |
| Molecular Formula | C14H10BrFN4O3S3 |
| Molecular Weight | 477.36 g/mol |
| Exact Mass | 475.91 |
| IUPAC Name | 1-(5-bromo-1,3-thiazol-2-yl)-3-[5-(6-fluoro-3-pyridinyl)-4-methylthiophen-2-yl]sulfonylurea |
| SMILES | Cc1cc(S(=O)(=O)NC(=O)Nc2ncc(Br)s2)sc1-c1ccc(F)nc1 |
| InChI | InChI=1S/C14H10BrFN4O3S3/c1-7-4-11(25-12(7)8-2-3-10(16)17-5-8)26(22,23)20-13(21)19-14-18-6-9(15)24-14/h2-6H,1H3,(H2,18,19,20,21) |
| InChIKey | GFHDZJKEYHPWMJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|