C11H7BrF2N2OS — CID 82815247
N-(5-bromo-1,3-thiazol-2-yl)-2,6-difluoro-3-methylbenzamide (PubChem CID 82815247) has the molecular formula C11H7BrF2N2OS and a molecular weight of 333.16 g/mol. Its IUPAC name is N-(5-bromo-1,3-thiazol-2-yl)-2,6-difluoro-3-methylbenzamide.
| Compound Name | N-(5-bromo-1,3-thiazol-2-yl)-2,6-difluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 82815247 |
| Molecular Formula | C11H7BrF2N2OS |
| Molecular Weight | 333.16 g/mol |
| Exact Mass | 331.94 |
| IUPAC Name | N-(5-bromo-1,3-thiazol-2-yl)-2,6-difluoro-3-methylbenzamide |
| SMILES | Cc1ccc(F)c(C(=O)Nc2ncc(Br)s2)c1F |
| InChI | InChI=1S/C11H7BrF2N2OS/c1-5-2-3-6(13)8(9(5)14)10(17)16-11-15-4-7(12)18-11/h2-4H,1H3,(H,15,16,17) |
| InChIKey | GJYVNZOEUDJTEK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.16 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |