C10H9BrFN3O2S2 — CID 115421295
3-amino-N-(5-bromo-1,3-thiazol-2-yl)-4-fluoro-5-methylbenzenesulfonamide (PubChem CID 115421295) has the molecular formula C10H9BrFN3O2S2 and a molecular weight of 366.24 g/mol. Its IUPAC name is 3-amino-N-(5-bromo-1,3-thiazol-2-yl)-4-fluoro-5-methylbenzenesulfonamide.
| Compound Name | 3-amino-N-(5-bromo-1,3-thiazol-2-yl)-4-fluoro-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 115421295 |
| Molecular Formula | C10H9BrFN3O2S2 |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 364.93 |
| IUPAC Name | 3-amino-N-(5-bromo-1,3-thiazol-2-yl)-4-fluoro-5-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2ncc(Br)s2)cc(N)c1F |
| InChI | InChI=1S/C10H9BrFN3O2S2/c1-5-2-6(3-7(13)9(5)12)19(16,17)15-10-14-4-8(11)18-10/h2-4H,13H2,1H3,(H,14,15) |
| InChIKey | LJMGCWHGTPGJPS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|