C11H12BrN3O2S2 — CID 60785111
6-amino-N-(5-bromo-1,3-thiazol-2-yl)-2,3-dimethylbenzenesulfonamide (PubChem CID 60785111) has the molecular formula C11H12BrN3O2S2 and a molecular weight of 362.27 g/mol. Its IUPAC name is 6-amino-N-(5-bromo-1,3-thiazol-2-yl)-2,3-dimethylbenzenesulfonamide.
| Compound Name | 6-amino-N-(5-bromo-1,3-thiazol-2-yl)-2,3-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 60785111 |
| Molecular Formula | C11H12BrN3O2S2 |
| Molecular Weight | 362.27 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | 6-amino-N-(5-bromo-1,3-thiazol-2-yl)-2,3-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(N)c(S(=O)(=O)Nc2ncc(Br)s2)c1C |
| InChI | InChI=1S/C11H12BrN3O2S2/c1-6-3-4-8(13)10(7(6)2)19(16,17)15-11-14-5-9(12)18-11/h3-5H,13H2,1-2H3,(H,14,15) |
| InChIKey | CJYSYBKJNUUANO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|