About 1-(5-bromo-1,3-thiazol-2-yl)-3-(3,5-dichlorophenyl)urea
1-(5-bromo-1,3-thiazol-2-yl)-3-(3,5-dichlorophenyl)urea (PubChem CID 107653631) has the molecular formula C10H6BrCl2N3OS
and a molecular weight of 367.06 g/mol. Its IUPAC name is 1-(5-bromo-1,3-thiazol-2-yl)-3-(3,5-dichlorophenyl)urea.
Molecular Properties
| Compound Name | 1-(5-bromo-1,3-thiazol-2-yl)-3-(3,5-dichlorophenyl)urea |
| PubChem CID | 107653631 |
| Molecular Formula | C10H6BrCl2N3OS |
| Molecular Weight | 367.06 g/mol |
| Exact Mass | 364.88 |
| IUPAC Name | 1-(5-bromo-1,3-thiazol-2-yl)-3-(3,5-dichlorophenyl)urea |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)Nc1ncc(Br)s1 |
| InChI | InChI=1S/C10H6BrCl2N3OS/c11-8-4-14-10(18-8)16-9(17)15-7-2-5(12)1-6(13)3-7/h1-4H,(H2,14,15,16,17) |
| InChIKey | AWSKWTHVOVAAQQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.06 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(5-bromo-1,3-thiazol-2-yl)-3-(3,5-dichlorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromo-1,3-thiazol-2-yl)-3-(3,5-dichlorophenyl)urea?
The IUPAC name of 1-(5-bromo-1,3-thiazol-2-yl)-3-(3,5-dichlorophenyl)urea (CID 107653631) is 1-(5-bromo-1,3-thiazol-2-yl)-3-(3,5-dichlorophenyl)urea.
What is the SMILES notation for 1-(5-bromo-1,3-thiazol-2-yl)-3-(3,5-dichlorophenyl)urea?
The canonical SMILES for 1-(5-bromo-1,3-thiazol-2-yl)-3-(3,5-dichlorophenyl)urea is O=C(Nc1cc(Cl)cc(Cl)c1)Nc1ncc(Br)s1.
What is the InChIKey of 1-(5-bromo-1,3-thiazol-2-yl)-3-(3,5-dichlorophenyl)urea?
The InChIKey is AWSKWTHVOVAAQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6BrCl2N3OS/c11-8-4-14-10(18-8)16-9(17)15-7-2-5(12)1-6(13)3-7/h1-4H,(H2,14,15,16,17).
What are the key properties of 1-(5-bromo-1,3-thiazol-2-yl)-3-(3,5-dichlorophenyl)urea?
1-(5-bromo-1,3-thiazol-2-yl)-3-(3,5-dichlorophenyl)urea has a molecular weight of 367.06 g/mol, XLogP of 4.86, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromo-1,3-thiazol-2-yl)-3-(3,5-dichlorophenyl)urea is sourced from PubChem (CID 107653631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).