C10H6BrCl2N3OS — CID 107653631
1-(5-bromo-1,3-thiazol-2-yl)-3-(3,5-dichlorophenyl)urea (PubChem CID 107653631) has the molecular formula C10H6BrCl2N3OS and a molecular weight of 367.06 g/mol. Its IUPAC name is 1-(5-bromo-1,3-thiazol-2-yl)-3-(3,5-dichlorophenyl)urea.
| Compound Name | 1-(5-bromo-1,3-thiazol-2-yl)-3-(3,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 107653631 |
| Molecular Formula | C10H6BrCl2N3OS |
| Molecular Weight | 367.06 g/mol |
| Exact Mass | 364.88 |
| IUPAC Name | 1-(5-bromo-1,3-thiazol-2-yl)-3-(3,5-dichlorophenyl)urea |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)Nc1ncc(Br)s1 |
| InChI | InChI=1S/C10H6BrCl2N3OS/c11-8-4-14-10(18-8)16-9(17)15-7-2-5(12)1-6(13)3-7/h1-4H,(H2,14,15,16,17) |
| InChIKey | AWSKWTHVOVAAQQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.06 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |