C12H14Cl2N2O2S2 — CID 62957301
2-[(3,4-dichlorophenyl)sulfonylamino]cyclopentane-1-carbothioamide (PubChem CID 62957301) has the molecular formula C12H14Cl2N2O2S2 and a molecular weight of 353.30 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)sulfonylamino]cyclopentane-1-carbothioamide.
| Compound Name | 2-[(3,4-dichlorophenyl)sulfonylamino]cyclopentane-1-carbothioamide |
|---|---|
| PubChem CID | 62957301 |
| Molecular Formula | C12H14Cl2N2O2S2 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)sulfonylamino]cyclopentane-1-carbothioamide |
| SMILES | NC(=S)C1CCCC1NS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2N2O2S2/c13-9-5-4-7(6-10(9)14)20(17,18)16-11-3-1-2-8(11)12(15)19/h4-6,8,11,16H,1-3H2,(H2,15,19) |
| InChIKey | VTKRRDOGFPSVOA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|