C12H14Cl3NO2S — CID 65030631
3,4-dichloro-N-(2-chlorocyclohexyl)benzenesulfonamide (PubChem CID 65030631) has the molecular formula C12H14Cl3NO2S and a molecular weight of 342.68 g/mol. Its IUPAC name is 3,4-dichloro-N-(2-chlorocyclohexyl)benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-(2-chlorocyclohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 65030631 |
| Molecular Formula | C12H14Cl3NO2S |
| Molecular Weight | 342.68 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | 3,4-dichloro-N-(2-chlorocyclohexyl)benzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCCC1Cl)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H14Cl3NO2S/c13-9-6-5-8(7-11(9)15)19(17,18)16-12-4-2-1-3-10(12)14/h5-7,10,12,16H,1-4H2 |
| InChIKey | BSSTXGTXFTZZBS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.68 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|