C13H17ClFNO2S — CID 113395199
N-(2-chlorocycloheptyl)-3-fluorobenzenesulfonamide (PubChem CID 113395199) has the molecular formula C13H17ClFNO2S and a molecular weight of 305.80 g/mol. Its IUPAC name is N-(2-chlorocycloheptyl)-3-fluorobenzenesulfonamide.
| Compound Name | N-(2-chlorocycloheptyl)-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 113395199 |
| Molecular Formula | C13H17ClFNO2S |
| Molecular Weight | 305.80 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | N-(2-chlorocycloheptyl)-3-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCCCC1Cl)c1cccc(F)c1 |
| InChI | InChI=1S/C13H17ClFNO2S/c14-12-7-2-1-3-8-13(12)16-19(17,18)11-6-4-5-10(15)9-11/h4-6,9,12-13,16H,1-3,7-8H2 |
| InChIKey | MACCEMIOLJCUFW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.80 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|