C12H14ClF2NO2S — CID 65032633
N-(2-chlorocyclohexyl)-2,5-difluorobenzenesulfonamide (PubChem CID 65032633) has the molecular formula C12H14ClF2NO2S and a molecular weight of 309.77 g/mol. Its IUPAC name is N-(2-chlorocyclohexyl)-2,5-difluorobenzenesulfonamide.
| Compound Name | N-(2-chlorocyclohexyl)-2,5-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 65032633 |
| Molecular Formula | C12H14ClF2NO2S |
| Molecular Weight | 309.77 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | N-(2-chlorocyclohexyl)-2,5-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCCC1Cl)c1cc(F)ccc1F |
| InChI | InChI=1S/C12H14ClF2NO2S/c13-9-3-1-2-4-11(9)16-19(17,18)12-7-8(14)5-6-10(12)15/h5-7,9,11,16H,1-4H2 |
| InChIKey | KUBWDNMGJYDUAI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.77 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|