C13H18FNO3S — CID 104953272
2-fluoro-N-[(1S,2S)-2-hydroxycyclohexyl]-5-methylbenzenesulfonamide (PubChem CID 104953272) has the molecular formula C13H18FNO3S and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-fluoro-N-[(1S,2S)-2-hydroxycyclohexyl]-5-methylbenzenesulfonamide.
| Compound Name | 2-fluoro-N-[(1S,2S)-2-hydroxycyclohexyl]-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 104953272 |
| Molecular Formula | C13H18FNO3S |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2-fluoro-N-[(1S,2S)-2-hydroxycyclohexyl]-5-methylbenzenesulfonamide |
| SMILES | Cc1ccc(F)c(S(=O)(=O)N[C@H]2CCCC[C@@H]2O)c1 |
| InChI | InChI=1S/C13H18FNO3S/c1-9-6-7-10(14)13(8-9)19(17,18)15-11-4-2-3-5-12(11)16/h6-8,11-12,15-16H,2-5H2,1H3/t11-,12-/m0/s1 |
| InChIKey | NNCVZVUBIVVMNT-RYUDHWBXSA-N |
| XLogP | 1.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |