C12H15BrFNO3S — CID 104953223
2-bromo-4-fluoro-N-[(1S,2S)-2-hydroxycyclohexyl]benzenesulfonamide (PubChem CID 104953223) has the molecular formula C12H15BrFNO3S and a molecular weight of 352.23 g/mol. Its IUPAC name is 2-bromo-4-fluoro-N-[(1S,2S)-2-hydroxycyclohexyl]benzenesulfonamide.
| Compound Name | 2-bromo-4-fluoro-N-[(1S,2S)-2-hydroxycyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 104953223 |
| Molecular Formula | C12H15BrFNO3S |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | 2-bromo-4-fluoro-N-[(1S,2S)-2-hydroxycyclohexyl]benzenesulfonamide |
| SMILES | O=S(=O)(N[C@H]1CCCC[C@@H]1O)c1ccc(F)cc1Br |
| InChI | InChI=1S/C12H15BrFNO3S/c13-9-7-8(14)5-6-12(9)19(17,18)15-10-3-1-2-4-11(10)16/h5-7,10-11,15-16H,1-4H2/t10-,11-/m0/s1 |
| InChIKey | GZYSVYJUIGKNFA-QWRGUYRKSA-N |
| XLogP | 2.17 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |