C10H11BrFNO3S — CID 80713106
2-bromo-4-fluoro-N-(oxolan-3-yl)benzenesulfonamide (PubChem CID 80713106) has the molecular formula C10H11BrFNO3S and a molecular weight of 324.17 g/mol. Its IUPAC name is 2-bromo-4-fluoro-N-(oxolan-3-yl)benzenesulfonamide.
| Compound Name | 2-bromo-4-fluoro-N-(oxolan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 80713106 |
| Molecular Formula | C10H11BrFNO3S |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 322.96 |
| IUPAC Name | 2-bromo-4-fluoro-N-(oxolan-3-yl)benzenesulfonamide |
| SMILES | O=S(=O)(NC1CCOC1)c1ccc(F)cc1Br |
| InChI | InChI=1S/C10H11BrFNO3S/c11-9-5-7(12)1-2-10(9)17(14,15)13-8-3-4-16-6-8/h1-2,5,8,13H,3-4,6H2 |
| InChIKey | WHHWRBVSYZISQM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |