C13H17BrFNO2S — CID 47257511
2-bromo-4-fluoro-N-(3-methylcyclohexyl)benzenesulfonamide (PubChem CID 47257511) has the molecular formula C13H17BrFNO2S and a molecular weight of 350.25 g/mol. Its IUPAC name is 2-bromo-4-fluoro-N-(3-methylcyclohexyl)benzenesulfonamide.
| Compound Name | 2-bromo-4-fluoro-N-(3-methylcyclohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 47257511 |
| Molecular Formula | C13H17BrFNO2S |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 2-bromo-4-fluoro-N-(3-methylcyclohexyl)benzenesulfonamide |
| SMILES | CC1CCCC(NS(=O)(=O)c2ccc(F)cc2Br)C1 |
| InChI | InChI=1S/C13H17BrFNO2S/c1-9-3-2-4-11(7-9)16-19(17,18)13-6-5-10(15)8-12(13)14/h5-6,8-9,11,16H,2-4,7H2,1H3 |
| InChIKey | JQNXZADNLBOLEM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |