C13H17BrFNO3S — CID 115563559
2-bromo-N-(2,2-dimethyloxan-4-yl)-4-fluorobenzenesulfonamide (PubChem CID 115563559) has the molecular formula C13H17BrFNO3S and a molecular weight of 366.25 g/mol. Its IUPAC name is 2-bromo-N-(2,2-dimethyloxan-4-yl)-4-fluorobenzenesulfonamide.
| Compound Name | 2-bromo-N-(2,2-dimethyloxan-4-yl)-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 115563559 |
| Molecular Formula | C13H17BrFNO3S |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 2-bromo-N-(2,2-dimethyloxan-4-yl)-4-fluorobenzenesulfonamide |
| SMILES | CC1(C)CC(NS(=O)(=O)c2ccc(F)cc2Br)CCO1 |
| InChI | InChI=1S/C13H17BrFNO3S/c1-13(2)8-10(5-6-19-13)16-20(17,18)12-4-3-9(15)7-11(12)14/h3-4,7,10,16H,5-6,8H2,1-2H3 |
| InChIKey | BAOOZVIVFLQFLJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |