C13H18BrFN2O3S — CID 106491998
2-amino-5-bromo-N-(2,2-dimethyloxan-4-yl)-4-fluorobenzenesulfonamide (PubChem CID 106491998) has the molecular formula C13H18BrFN2O3S and a molecular weight of 381.27 g/mol. Its IUPAC name is 2-amino-5-bromo-N-(2,2-dimethyloxan-4-yl)-4-fluorobenzenesulfonamide.
| Compound Name | 2-amino-5-bromo-N-(2,2-dimethyloxan-4-yl)-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 106491998 |
| Molecular Formula | C13H18BrFN2O3S |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 2-amino-5-bromo-N-(2,2-dimethyloxan-4-yl)-4-fluorobenzenesulfonamide |
| SMILES | CC1(C)CC(NS(=O)(=O)c2cc(Br)c(F)cc2N)CCO1 |
| InChI | InChI=1S/C13H18BrFN2O3S/c1-13(2)7-8(3-4-20-13)17-21(18,19)12-5-9(14)10(15)6-11(12)16/h5-6,8,17H,3-4,7,16H2,1-2H3 |
| InChIKey | BRRMZOMFOMLSDG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|