C10H11BrFN3O3S — CID 106180872
2-amino-5-bromo-4-fluoro-N-(5-oxopyrrolidin-3-yl)benzenesulfonamide (PubChem CID 106180872) has the molecular formula C10H11BrFN3O3S and a molecular weight of 352.19 g/mol. Its IUPAC name is 2-amino-5-bromo-4-fluoro-N-(5-oxopyrrolidin-3-yl)benzenesulfonamide.
| Compound Name | 2-amino-5-bromo-4-fluoro-N-(5-oxopyrrolidin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106180872 |
| Molecular Formula | C10H11BrFN3O3S |
| Molecular Weight | 352.19 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | 2-amino-5-bromo-4-fluoro-N-(5-oxopyrrolidin-3-yl)benzenesulfonamide |
| SMILES | Nc1cc(F)c(Br)cc1S(=O)(=O)NC1CNC(=O)C1 |
| InChI | InChI=1S/C10H11BrFN3O3S/c11-6-2-9(8(13)3-7(6)12)19(17,18)15-5-1-10(16)14-4-5/h2-3,5,15H,1,4,13H2,(H,14,16) |
| InChIKey | MGAREDNSIATFSK-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.19 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|