C10H12BrFN2O2S2 — CID 106492192
2-amino-5-bromo-4-fluoro-N-(thiolan-3-yl)benzenesulfonamide (PubChem CID 106492192) has the molecular formula C10H12BrFN2O2S2 and a molecular weight of 355.25 g/mol. Its IUPAC name is 2-amino-5-bromo-4-fluoro-N-(thiolan-3-yl)benzenesulfonamide.
| Compound Name | 2-amino-5-bromo-4-fluoro-N-(thiolan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106492192 |
| Molecular Formula | C10H12BrFN2O2S2 |
| Molecular Weight | 355.25 g/mol |
| Exact Mass | 353.95 |
| IUPAC Name | 2-amino-5-bromo-4-fluoro-N-(thiolan-3-yl)benzenesulfonamide |
| SMILES | Nc1cc(F)c(Br)cc1S(=O)(=O)NC1CCSC1 |
| InChI | InChI=1S/C10H12BrFN2O2S2/c11-7-3-10(9(13)4-8(7)12)18(15,16)14-6-1-2-17-5-6/h3-4,6,14H,1-2,5,13H2 |
| InChIKey | DDNWLSYZZBZNKJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|