C11H16N2O4S3 — CID 103064624
2-amino-5-methylsulfonyl-N-(thiolan-3-yl)benzenesulfonamide (PubChem CID 103064624) has the molecular formula C11H16N2O4S3 and a molecular weight of 336.46 g/mol. Its IUPAC name is 2-amino-5-methylsulfonyl-N-(thiolan-3-yl)benzenesulfonamide.
| Compound Name | 2-amino-5-methylsulfonyl-N-(thiolan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 103064624 |
| Molecular Formula | C11H16N2O4S3 |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 2-amino-5-methylsulfonyl-N-(thiolan-3-yl)benzenesulfonamide |
| SMILES | CS(=O)(=O)c1ccc(N)c(S(=O)(=O)NC2CCSC2)c1 |
| InChI | InChI=1S/C11H16N2O4S3/c1-19(14,15)9-2-3-10(12)11(6-9)20(16,17)13-8-4-5-18-7-8/h2-3,6,8,13H,4-5,7,12H2,1H3 |
| InChIKey | LEZFSNJPOOYUJA-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|