C13H20N2O4S2 — CID 63994997
2-amino-N-(1-cyclopropylpropan-2-yl)-5-methylsulfonylbenzenesulfonamide (PubChem CID 63994997) has the molecular formula C13H20N2O4S2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 2-amino-N-(1-cyclopropylpropan-2-yl)-5-methylsulfonylbenzenesulfonamide.
| Compound Name | 2-amino-N-(1-cyclopropylpropan-2-yl)-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 63994997 |
| Molecular Formula | C13H20N2O4S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 2-amino-N-(1-cyclopropylpropan-2-yl)-5-methylsulfonylbenzenesulfonamide |
| SMILES | CC(CC1CC1)NS(=O)(=O)c1cc(S(C)(=O)=O)ccc1N |
| InChI | InChI=1S/C13H20N2O4S2/c1-9(7-10-3-4-10)15-21(18,19)13-8-11(20(2,16)17)5-6-12(13)14/h5-6,8-10,15H,3-4,7,14H2,1-2H3 |
| InChIKey | NQOHYHHTGOPYAF-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|