C12H18N2O4S2 — CID 62145505
2-amino-N-(cyclopropylmethyl)-N-methyl-5-methylsulfonylbenzenesulfonamide (PubChem CID 62145505) has the molecular formula C12H18N2O4S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-amino-N-(cyclopropylmethyl)-N-methyl-5-methylsulfonylbenzenesulfonamide.
| Compound Name | 2-amino-N-(cyclopropylmethyl)-N-methyl-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 62145505 |
| Molecular Formula | C12H18N2O4S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 2-amino-N-(cyclopropylmethyl)-N-methyl-5-methylsulfonylbenzenesulfonamide |
| SMILES | CN(CC1CC1)S(=O)(=O)c1cc(S(C)(=O)=O)ccc1N |
| InChI | InChI=1S/C12H18N2O4S2/c1-14(8-9-3-4-9)20(17,18)12-7-10(19(2,15)16)5-6-11(12)13/h5-7,9H,3-4,8,13H2,1-2H3 |
| InChIKey | DDJLRBIIQPFKMC-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|