C12H20N2O5S2 — CID 79377506
2-amino-N-(2-hydroxy-2-methylpropyl)-N-methyl-5-methylsulfonylbenzenesulfonamide (PubChem CID 79377506) has the molecular formula C12H20N2O5S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-amino-N-(2-hydroxy-2-methylpropyl)-N-methyl-5-methylsulfonylbenzenesulfonamide.
| Compound Name | 2-amino-N-(2-hydroxy-2-methylpropyl)-N-methyl-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 79377506 |
| Molecular Formula | C12H20N2O5S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2-amino-N-(2-hydroxy-2-methylpropyl)-N-methyl-5-methylsulfonylbenzenesulfonamide |
| SMILES | CN(CC(C)(C)O)S(=O)(=O)c1cc(S(C)(=O)=O)ccc1N |
| InChI | InChI=1S/C12H20N2O5S2/c1-12(2,15)8-14(3)21(18,19)11-7-9(20(4,16)17)5-6-10(11)13/h5-7,15H,8,13H2,1-4H3 |
| InChIKey | VHBZEGDUBAOICA-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|