C14H19N3O3S — CID 104850488
5-amino-N-(2-hydroxy-2-methylpropyl)-N-methylquinoline-8-sulfonamide (PubChem CID 104850488) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is 5-amino-N-(2-hydroxy-2-methylpropyl)-N-methylquinoline-8-sulfonamide.
| Compound Name | 5-amino-N-(2-hydroxy-2-methylpropyl)-N-methylquinoline-8-sulfonamide |
|---|---|
| PubChem CID | 104850488 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 5-amino-N-(2-hydroxy-2-methylpropyl)-N-methylquinoline-8-sulfonamide |
| SMILES | CN(CC(C)(C)O)S(=O)(=O)c1ccc(N)c2cccnc12 |
| InChI | InChI=1S/C14H19N3O3S/c1-14(2,18)9-17(3)21(19,20)12-7-6-11(15)10-5-4-8-16-13(10)12/h4-8,18H,9,15H2,1-3H3 |
| InChIKey | YHIXWCRIGUMNIM-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|