C15H21ClN4O4S — CID 120712188
N-(3-amino-2,2-dimethylpropyl)-N-methyl-5-nitroquinoline-8-sulfonamide;hydrochloride (PubChem CID 120712188) has the molecular formula C15H21ClN4O4S and a molecular weight of 388.88 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-N-methyl-5-nitroquinoline-8-sulfonamide;hydrochloride.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-N-methyl-5-nitroquinoline-8-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120712188 |
| Molecular Formula | C15H21ClN4O4S |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-N-methyl-5-nitroquinoline-8-sulfonamide;hydrochloride |
| SMILES | CN(CC(C)(C)CN)S(=O)(=O)c1ccc([N+](=O)[O-])c2cccnc12.Cl |
| InChI | InChI=1S/C15H20N4O4S.ClH/c1-15(2,9-16)10-18(3)24(22,23)13-7-6-12(19(20)21)11-5-4-8-17-14(11)13;/h4-8H,9-10,16H2,1-3H3;1H |
| InChIKey | OVXWCGMNKQMZLP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|