C11H17ClN2O3S — CID 115330222
4-amino-3-chloro-N-(2-hydroxy-2-methylpropyl)-N-methylbenzenesulfonamide (PubChem CID 115330222) has the molecular formula C11H17ClN2O3S and a molecular weight of 292.79 g/mol. Its IUPAC name is 4-amino-3-chloro-N-(2-hydroxy-2-methylpropyl)-N-methylbenzenesulfonamide.
| Compound Name | 4-amino-3-chloro-N-(2-hydroxy-2-methylpropyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 115330222 |
| Molecular Formula | C11H17ClN2O3S |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 4-amino-3-chloro-N-(2-hydroxy-2-methylpropyl)-N-methylbenzenesulfonamide |
| SMILES | CN(CC(C)(C)O)S(=O)(=O)c1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C11H17ClN2O3S/c1-11(2,15)7-14(3)18(16,17)8-4-5-10(13)9(12)6-8/h4-6,15H,7,13H2,1-3H3 |
| InChIKey | RHDCLGPQGDWLGH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|