C13H18ClNO4S — CID 107090039
2-chloro-4-[2,2-dimethylpropyl(methyl)sulfamoyl]benzoic acid (PubChem CID 107090039) has the molecular formula C13H18ClNO4S and a molecular weight of 319.81 g/mol. Its IUPAC name is 2-chloro-4-[2,2-dimethylpropyl(methyl)sulfamoyl]benzoic acid.
| Compound Name | 2-chloro-4-[2,2-dimethylpropyl(methyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 107090039 |
| Molecular Formula | C13H18ClNO4S |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 2-chloro-4-[2,2-dimethylpropyl(methyl)sulfamoyl]benzoic acid |
| SMILES | CN(CC(C)(C)C)S(=O)(=O)c1ccc(C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C13H18ClNO4S/c1-13(2,3)8-15(4)20(18,19)9-5-6-10(12(16)17)11(14)7-9/h5-7H,8H2,1-4H3,(H,16,17) |
| InChIKey | XPFKNRAFRBJYOY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |