2-chloro-4-[2,2-dimethylpropyl(methyl)sulfamoyl]benzoic acid

C13H18ClNO4S — CID 107090039

IUPAC2-chloro-4-[2,2-dimethylpropyl(methyl)sulfamoyl]benzoic acid
SMILESCN(CC(C)(C)C)S(=O)(=O)c1ccc(C(=O)O)c(Cl)c1
InChIInChI=1S/C13H18ClNO4S/c1-13(2,3)8-15(4)20(18,19)9-5-6-10(12(16)17)11(14)7-9/h5-7H,8H2,1-4H3,(H,16,17)
InChIKeyXPFKNRAFRBJYOY-UHFFFAOYSA-N
MW319.81 g/mol
LogP2.70
Rot. Bonds4

About 2-chloro-4-[2,2-dimethylpropyl(methyl)sulfamoyl]benzoic acid

2-chloro-4-[2,2-dimethylpropyl(methyl)sulfamoyl]benzoic acid (PubChem CID 107090039) has the molecular formula C13H18ClNO4S and a molecular weight of 319.81 g/mol. Its IUPAC name is 2-chloro-4-[2,2-dimethylpropyl(methyl)sulfamoyl]benzoic acid.

Molecular Properties

Compound Name2-chloro-4-[2,2-dimethylpropyl(methyl)sulfamoyl]benzoic acid
PubChem CID107090039
Molecular FormulaC13H18ClNO4S
Molecular Weight319.81 g/mol
Exact Mass319.06
IUPAC Name2-chloro-4-[2,2-dimethylpropyl(methyl)sulfamoyl]benzoic acid
SMILESCN(CC(C)(C)C)S(=O)(=O)c1ccc(C(=O)O)c(Cl)c1
InChIInChI=1S/C13H18ClNO4S/c1-13(2,3)8-15(4)20(18,19)9-5-6-10(12(16)17)11(14)7-9/h5-7H,8H2,1-4H3,(H,16,17)
InChIKeyXPFKNRAFRBJYOY-UHFFFAOYSA-N
XLogP2.70
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500319.81
LogP ≤ 52.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-chloro-4-[2,2-dimethylpropyl(methyl)sulfamoyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-chloro-4-[2,2-dimethylpropyl(methyl)sulfamoyl]benzoic acid?
The IUPAC name of 2-chloro-4-[2,2-dimethylpropyl(methyl)sulfamoyl]benzoic acid (CID 107090039) is 2-chloro-4-[2,2-dimethylpropyl(methyl)sulfamoyl]benzoic acid.
What is the SMILES notation for 2-chloro-4-[2,2-dimethylpropyl(methyl)sulfamoyl]benzoic acid?
The canonical SMILES for 2-chloro-4-[2,2-dimethylpropyl(methyl)sulfamoyl]benzoic acid is CN(CC(C)(C)C)S(=O)(=O)c1ccc(C(=O)O)c(Cl)c1.
What is the InChIKey of 2-chloro-4-[2,2-dimethylpropyl(methyl)sulfamoyl]benzoic acid?
The InChIKey is XPFKNRAFRBJYOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClNO4S/c1-13(2,3)8-15(4)20(18,19)9-5-6-10(12(16)17)11(14)7-9/h5-7H,8H2,1-4H3,(H,16,17).
What are the key properties of 2-chloro-4-[2,2-dimethylpropyl(methyl)sulfamoyl]benzoic acid?
2-chloro-4-[2,2-dimethylpropyl(methyl)sulfamoyl]benzoic acid has a molecular weight of 319.81 g/mol, XLogP of 2.70, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-[2,2-dimethylpropyl(methyl)sulfamoyl]benzoic acid is sourced from PubChem (CID 107090039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).