C12H15ClN2O5S — CID 107089932
4-[(2-amino-2-oxoethyl)-propan-2-ylsulfamoyl]-2-chlorobenzoic acid (PubChem CID 107089932) has the molecular formula C12H15ClN2O5S and a molecular weight of 334.78 g/mol. Its IUPAC name is 4-[(2-amino-2-oxoethyl)-propan-2-ylsulfamoyl]-2-chlorobenzoic acid.
| Compound Name | 4-[(2-amino-2-oxoethyl)-propan-2-ylsulfamoyl]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 107089932 |
| Molecular Formula | C12H15ClN2O5S |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 4-[(2-amino-2-oxoethyl)-propan-2-ylsulfamoyl]-2-chlorobenzoic acid |
| SMILES | CC(C)N(CC(N)=O)S(=O)(=O)c1ccc(C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C12H15ClN2O5S/c1-7(2)15(6-11(14)16)21(19,20)8-3-4-9(12(17)18)10(13)5-8/h3-5,7H,6H2,1-2H3,(H2,14,16)(H,17,18) |
| InChIKey | MADJNCWPDNNSFS-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |