C11H12ClNO5S — CID 107090472
2-chloro-4-[2-(dimethylamino)-2-oxoethyl]sulfonylbenzoic acid (PubChem CID 107090472) has the molecular formula C11H12ClNO5S and a molecular weight of 305.74 g/mol. Its IUPAC name is 2-chloro-4-[2-(dimethylamino)-2-oxoethyl]sulfonylbenzoic acid.
| Compound Name | 2-chloro-4-[2-(dimethylamino)-2-oxoethyl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 107090472 |
| Molecular Formula | C11H12ClNO5S |
| Molecular Weight | 305.74 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 2-chloro-4-[2-(dimethylamino)-2-oxoethyl]sulfonylbenzoic acid |
| SMILES | CN(C)C(=O)CS(=O)(=O)c1ccc(C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C11H12ClNO5S/c1-13(2)10(14)6-19(17,18)7-3-4-8(11(15)16)9(12)5-7/h3-5H,6H2,1-2H3,(H,15,16) |
| InChIKey | QESZQALIVMHWFM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.74 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |