C10H10ClFO4S — CID 107090569
2-chloro-4-(3-fluoropropylsulfonyl)benzoic acid (PubChem CID 107090569) has the molecular formula C10H10ClFO4S and a molecular weight of 280.70 g/mol. Its IUPAC name is 2-chloro-4-(3-fluoropropylsulfonyl)benzoic acid.
| Compound Name | 2-chloro-4-(3-fluoropropylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 107090569 |
| Molecular Formula | C10H10ClFO4S |
| Molecular Weight | 280.70 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | 2-chloro-4-(3-fluoropropylsulfonyl)benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)CCCF)cc1Cl |
| InChI | InChI=1S/C10H10ClFO4S/c11-9-6-7(2-3-8(9)10(13)14)17(15,16)5-1-4-12/h2-3,6H,1,4-5H2,(H,13,14) |
| InChIKey | IHXNHODTKYRDKL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.70 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |