C15H13ClO5S — CID 66877737
2-chloro-4-[(2R)-2-hydroxy-2-phenylethyl]sulfonylbenzoic acid (PubChem CID 66877737) has the molecular formula C15H13ClO5S and a molecular weight of 340.78 g/mol. Its IUPAC name is 2-chloro-4-[(2R)-2-hydroxy-2-phenylethyl]sulfonylbenzoic acid.
| Compound Name | 2-chloro-4-[(2R)-2-hydroxy-2-phenylethyl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 66877737 |
| Molecular Formula | C15H13ClO5S |
| Molecular Weight | 340.78 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 2-chloro-4-[(2R)-2-hydroxy-2-phenylethyl]sulfonylbenzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)C[C@H](O)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C15H13ClO5S/c16-13-8-11(6-7-12(13)15(18)19)22(20,21)9-14(17)10-4-2-1-3-5-10/h1-8,14,17H,9H2,(H,18,19)/t14-/m0/s1 |
| InChIKey | IAOWUROVAVGHQD-AWEZNQCLSA-N |
| XLogP | 2.55 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.78 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |