C10H10ClNO5S — CID 107090466
2-chloro-4-[2-(methylamino)-2-oxoethyl]sulfonylbenzoic acid (PubChem CID 107090466) has the molecular formula C10H10ClNO5S and a molecular weight of 291.71 g/mol. Its IUPAC name is 2-chloro-4-[2-(methylamino)-2-oxoethyl]sulfonylbenzoic acid.
| Compound Name | 2-chloro-4-[2-(methylamino)-2-oxoethyl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 107090466 |
| Molecular Formula | C10H10ClNO5S |
| Molecular Weight | 291.71 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 2-chloro-4-[2-(methylamino)-2-oxoethyl]sulfonylbenzoic acid |
| SMILES | CNC(=O)CS(=O)(=O)c1ccc(C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C10H10ClNO5S/c1-12-9(13)5-18(16,17)6-2-3-7(10(14)15)8(11)4-6/h2-4H,5H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | AHNRODRGIJHUQN-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.71 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |