C9H7ClF2O4S — CID 107090533
2-chloro-4-(2,2-difluoroethylsulfonyl)benzoic acid (PubChem CID 107090533) has the molecular formula C9H7ClF2O4S and a molecular weight of 284.67 g/mol. Its IUPAC name is 2-chloro-4-(2,2-difluoroethylsulfonyl)benzoic acid.
| Compound Name | 2-chloro-4-(2,2-difluoroethylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 107090533 |
| Molecular Formula | C9H7ClF2O4S |
| Molecular Weight | 284.67 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | 2-chloro-4-(2,2-difluoroethylsulfonyl)benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)CC(F)F)cc1Cl |
| InChI | InChI=1S/C9H7ClF2O4S/c10-7-3-5(1-2-6(7)9(13)14)17(15,16)4-8(11)12/h1-3,8H,4H2,(H,13,14) |
| InChIKey | OADMKVVSBZBPLS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.67 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |